C32H49FN2O7 — CID 155680675
tert-butyl N-[2-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 155680675) has the molecular formula C32H49FN2O7 and a molecular weight of 592.75 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 155680675 |
| Molecular Formula | C32H49FN2O7 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(OCCOCCOCCOCCOCCNC(=O)OC(C)(C)C)C(F)CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H49FN2O7/c1-26(29(33)25-35-30(27-11-7-5-8-12-27)28-13-9-6-10-14-28)41-24-23-40-22-21-39-20-19-38-18-17-37-16-15-34-31(36)42-32(2,3)4/h5-14,26,29-30,35H,15-25H2,1-4H3,(H,34,36) |
| InChIKey | SLCYTIFPUKDYHO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|