C8H16O4 — CID 58779511
2-(2-butan-2-yloxyethoxy)acetic acid (PubChem CID 58779511) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-(2-butan-2-yloxyethoxy)acetic acid.
| Compound Name | 2-(2-butan-2-yloxyethoxy)acetic acid |
|---|---|
| PubChem CID | 58779511 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-(2-butan-2-yloxyethoxy)acetic acid |
| SMILES | CCC(C)OCCOCC(=O)O |
| InChI | InChI=1S/C8H16O4/c1-3-7(2)12-5-4-11-6-8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | OWRVAGARGPSYBA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|