C14H26O7 — CID 118136972
4-[2-[2-[2-[(2R)-butan-2-yl]oxyethoxy]ethoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 118136972) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-[2-[2-[2-[(2R)-butan-2-yl]oxyethoxy]ethoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-[(2R)-butan-2-yl]oxyethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118136972 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-[2-[2-[2-[(2R)-butan-2-yl]oxyethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | CC[C@@H](C)OCCOCCOCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H26O7/c1-3-12(2)20-10-8-18-6-7-19-9-11-21-14(17)5-4-13(15)16/h12H,3-11H2,1-2H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | YDTFCTQXMHCSEQ-GFCCVEGCSA-N |
| XLogP | 1.24 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|