C15H29FN2O6 — CID 167520055
N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]propanamide (PubChem CID 167520055) has the molecular formula C15H29FN2O6 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 167520055 |
| Molecular Formula | C15H29FN2O6 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]propanamide |
| SMILES | CCC(=O)NCC(F)COCCOCCOCCNC(=O)COC |
| InChI | InChI=1S/C15H29FN2O6/c1-3-14(19)18-10-13(16)11-24-9-8-23-7-6-22-5-4-17-15(20)12-21-2/h13H,3-12H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | WHOKOIFTOJBYNX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|