C12H26FN3O3 — CID 142616700
N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide (PubChem CID 142616700) has the molecular formula C12H26FN3O3 and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 142616700 |
| Molecular Formula | C12H26FN3O3 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide |
| SMILES | CNCCOCCNCCOCC(F)CNC(C)=O |
| InChI | InChI=1S/C12H26FN3O3/c1-11(17)16-9-12(13)10-19-8-5-15-4-7-18-6-3-14-2/h12,14-15H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | REMYFJWNQFVPRL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|