C17H37N3O4 — CID 170218773
N-[2,3-dimethyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]acetamide (PubChem CID 170218773) has the molecular formula C17H37N3O4 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[2,3-dimethyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]acetamide.
| Compound Name | N-[2,3-dimethyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]acetamide |
|---|---|
| PubChem CID | 170218773 |
| Molecular Formula | C17H37N3O4 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | N-[2,3-dimethyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]acetamide |
| SMILES | CNCCOCCNCCOCCOC(C)(C)C(C)CNC(C)=O |
| InChI | InChI=1S/C17H37N3O4/c1-15(14-20-16(2)21)17(3,4)24-13-12-23-11-8-19-7-10-22-9-6-18-5/h15,18-19H,6-14H2,1-5H3,(H,20,21) |
| InChIKey | OXZLRNMAKBGDBM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|