C19H40FN3O3 — CID 138727987
N-[3-[2-[2-[2-(tert-butylamino)ethoxy]ethylamino]ethoxy]-2-fluoro-3-methylbutyl]-2-methylpropanamide (PubChem CID 138727987) has the molecular formula C19H40FN3O3 and a molecular weight of 377.55 g/mol. Its IUPAC name is N-[3-[2-[2-[2-(tert-butylamino)ethoxy]ethylamino]ethoxy]-2-fluoro-3-methylbutyl]-2-methylpropanamide.
| Compound Name | N-[3-[2-[2-[2-(tert-butylamino)ethoxy]ethylamino]ethoxy]-2-fluoro-3-methylbutyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 138727987 |
| Molecular Formula | C19H40FN3O3 |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | N-[3-[2-[2-[2-(tert-butylamino)ethoxy]ethylamino]ethoxy]-2-fluoro-3-methylbutyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCC(F)C(C)(C)OCCNCCOCCNC(C)(C)C |
| InChI | InChI=1S/C19H40FN3O3/c1-15(2)17(24)22-14-16(20)19(6,7)26-13-9-21-8-11-25-12-10-23-18(3,4)5/h15-16,21,23H,8-14H2,1-7H3,(H,22,24) |
| InChIKey | IRDDTDIBGGBHGN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|