C17H35FN2O4S — CID 167191784
N-[2-fluoro-3-methyl-3-[2-[2-[2-(1-sulfanylethylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide (PubChem CID 167191784) has the molecular formula C17H35FN2O4S and a molecular weight of 382.54 g/mol. Its IUPAC name is N-[2-fluoro-3-methyl-3-[2-[2-[2-(1-sulfanylethylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide.
| Compound Name | N-[2-fluoro-3-methyl-3-[2-[2-[2-(1-sulfanylethylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 167191784 |
| Molecular Formula | C17H35FN2O4S |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-[2-fluoro-3-methyl-3-[2-[2-[2-(1-sulfanylethylamino)ethoxy]ethoxy]ethoxy]butyl]-2-methylpropanamide |
| SMILES | CC(S)NCCOCCOCCOC(C)(C)C(F)CNC(=O)C(C)C |
| InChI | InChI=1S/C17H35FN2O4S/c1-13(2)16(21)20-12-15(18)17(4,5)24-11-10-23-9-8-22-7-6-19-14(3)25/h13-15,19,25H,6-12H2,1-5H3,(H,20,21) |
| InChIKey | JAIASEQROGXECS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|