C16H37FN2O3 — CID 142623147
ethane;N-[2-fluoro-3-methyl-3-[2-[2-(methylamino)ethoxy]ethoxy]butyl]acetamide (PubChem CID 142623147) has the molecular formula C16H37FN2O3 and a molecular weight of 324.48 g/mol. Its IUPAC name is ethane;N-[2-fluoro-3-methyl-3-[2-[2-(methylamino)ethoxy]ethoxy]butyl]acetamide.
| Compound Name | ethane;N-[2-fluoro-3-methyl-3-[2-[2-(methylamino)ethoxy]ethoxy]butyl]acetamide |
|---|---|
| PubChem CID | 142623147 |
| Molecular Formula | C16H37FN2O3 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | ethane;N-[2-fluoro-3-methyl-3-[2-[2-(methylamino)ethoxy]ethoxy]butyl]acetamide |
| SMILES | CC.CC.CNCCOCCOC(C)(C)C(F)CNC(C)=O |
| InChI | InChI=1S/C12H25FN2O3.2C2H6/c1-10(16)15-9-11(13)12(2,3)18-8-7-17-6-5-14-4;2*1-2/h11,14H,5-9H2,1-4H3,(H,15,16);2*1-2H3 |
| InChIKey | NCSMOQANGSBZCT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|