C18H37FN2O5S — CID 166118245
S-methyl N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamothioate (PubChem CID 166118245) has the molecular formula C18H37FN2O5S and a molecular weight of 412.57 g/mol. Its IUPAC name is S-methyl N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamothioate.
| Compound Name | S-methyl N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamothioate |
|---|---|
| PubChem CID | 166118245 |
| Molecular Formula | C18H37FN2O5S |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | S-methyl N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamothioate |
| SMILES | CSC(=O)NCC(F)C(C)(C)OCCOCCOCCOCCNC(C)C |
| InChI | InChI=1S/C18H37FN2O5S/c1-15(2)20-6-7-23-8-9-24-10-11-25-12-13-26-18(3,4)16(19)14-21-17(22)27-5/h15-16,20H,6-14H2,1-5H3,(H,21,22) |
| InChIKey | XIAACLWRVOTBSV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|