C16H32FN2O5SY- — CID 156794537
2-[2-[2-[2-[3-fluoro-2-methyl-4-(methylsulfanylcarbonylamino)butan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl-methylazanide;yttrium (PubChem CID 156794537) has the molecular formula C16H32FN2O5SY- and a molecular weight of 472.41 g/mol. Its IUPAC name is 2-[2-[2-[2-[3-fluoro-2-methyl-4-(methylsulfanylcarbonylamino)butan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl-methylazanide;yttrium.
| Compound Name | 2-[2-[2-[2-[3-fluoro-2-methyl-4-(methylsulfanylcarbonylamino)butan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl-methylazanide;yttrium |
|---|---|
| PubChem CID | 156794537 |
| Molecular Formula | C16H32FN2O5SY- |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[2-[2-[2-[3-fluoro-2-methyl-4-(methylsulfanylcarbonylamino)butan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl-methylazanide;yttrium |
| SMILES | C[N-]CCOCCOCCOCCOC(C)(C)C(F)CNC(=O)SC.[Y] |
| InChI | InChI=1S/C16H32FN2O5S.Y/c1-16(2,14(17)13-19-15(20)25-4)24-12-11-23-10-9-22-8-7-21-6-5-18-3;/h14H,5-13H2,1-4H3,(H,19,20);/q-1; |
| InChIKey | JAEKUIVLRHOJLT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|