C17H27FN2O4 — CID 138694418
benzyl N-[3-[2-(2-aminoethoxy)ethoxy]-2-fluoro-3-methylbutyl]carbamate (PubChem CID 138694418) has the molecular formula C17H27FN2O4 and a molecular weight of 342.41 g/mol. Its IUPAC name is benzyl N-[3-[2-(2-aminoethoxy)ethoxy]-2-fluoro-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[3-[2-(2-aminoethoxy)ethoxy]-2-fluoro-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 138694418 |
| Molecular Formula | C17H27FN2O4 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | benzyl N-[3-[2-(2-aminoethoxy)ethoxy]-2-fluoro-3-methylbutyl]carbamate |
| SMILES | CC(C)(OCCOCCN)C(F)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H27FN2O4/c1-17(2,24-11-10-22-9-8-19)15(18)12-20-16(21)23-13-14-6-4-3-5-7-14/h3-7,15H,8-13,19H2,1-2H3,(H,20,21) |
| InChIKey | WWZJOCXXEXLUNB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|