C19H40FN3O4 — CID 155750887
N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]propanamide (PubChem CID 155750887) has the molecular formula C19H40FN3O4 and a molecular weight of 393.54 g/mol. Its IUPAC name is N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]propanamide.
| Compound Name | N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]propanamide |
|---|---|
| PubChem CID | 155750887 |
| Molecular Formula | C19H40FN3O4 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]ethoxy]butyl]propanamide |
| SMILES | CCC(=O)NCC(F)C(C)(C)OCCOCCNCCOCCNC(C)C |
| InChI | InChI=1S/C19H40FN3O4/c1-6-18(24)23-15-17(20)19(4,5)27-14-13-26-11-8-21-7-10-25-12-9-22-16(2)3/h16-17,21-22H,6-15H2,1-5H3,(H,23,24) |
| InChIKey | SIXDDTLWGPTUBL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|