C21H43FN2O5 — CID 170007769
2-ethyl-N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]pentanamide (PubChem CID 170007769) has the molecular formula C21H43FN2O5 and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-ethyl-N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]pentanamide.
| Compound Name | 2-ethyl-N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]pentanamide |
|---|---|
| PubChem CID | 170007769 |
| Molecular Formula | C21H43FN2O5 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 2-ethyl-N-[2-fluoro-3-methyl-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]pentanamide |
| SMILES | CCCC(CC)C(=O)NCC(F)C(C)(C)OCCOCCOCCOCCNC |
| InChI | InChI=1S/C21H43FN2O5/c1-6-8-18(7-2)20(25)24-17-19(22)21(3,4)29-16-15-28-14-13-27-12-11-26-10-9-23-5/h18-19,23H,6-17H2,1-5H3,(H,24,25) |
| InChIKey | OHVUBZHBXKVHFL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|