C19H40N2O5 — CID 167271345
3,3-dimethyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 167271345) has the molecular formula C19H40N2O5 and a molecular weight of 376.54 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 167271345 |
| Molecular Formula | C19H40N2O5 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 3,3-dimethyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CC(C)NCCOCCOCCOCCOCCNC(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H40N2O5/c1-17(2)20-6-8-23-10-12-25-14-15-26-13-11-24-9-7-21-18(22)16-19(3,4)5/h17,20H,6-16H2,1-5H3,(H,21,22) |
| InChIKey | ISTZPZHNUJLGDR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|