C16H38N2O3 — CID 156820426
molecular hydrogen;2,2,3-trimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]butanamide (PubChem CID 156820426) has the molecular formula C16H38N2O3 and a molecular weight of 306.49 g/mol. Its IUPAC name is molecular hydrogen;2,2,3-trimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | molecular hydrogen;2,2,3-trimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 156820426 |
| Molecular Formula | C16H38N2O3 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | molecular hydrogen;2,2,3-trimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CC(C)NCCOCCOCCNC(=O)C(C)(C)C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C16H34N2O3.2H2/c1-13(2)16(5,6)15(19)18-8-10-21-12-11-20-9-7-17-14(3)4;;/h13-14,17H,7-12H2,1-6H3,(H,18,19);2*1H |
| InChIKey | VWQYMVXNCSMIKT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|