C16H32FN3O5S — CID 170061578
2-(4-acetamido-3-fluoro-2-methylbutan-2-yl)oxy-N-[2-[2-[2-(methylsulfanylamino)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 170061578) has the molecular formula C16H32FN3O5S and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-(4-acetamido-3-fluoro-2-methylbutan-2-yl)oxy-N-[2-[2-[2-(methylsulfanylamino)ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-(4-acetamido-3-fluoro-2-methylbutan-2-yl)oxy-N-[2-[2-[2-(methylsulfanylamino)ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 170061578 |
| Molecular Formula | C16H32FN3O5S |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-(4-acetamido-3-fluoro-2-methylbutan-2-yl)oxy-N-[2-[2-[2-(methylsulfanylamino)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CSNCCOCCOCCNC(=O)COC(C)(C)C(F)CNC(C)=O |
| InChI | InChI=1S/C16H32FN3O5S/c1-13(21)19-11-14(17)16(2,3)25-12-15(22)18-5-7-23-9-10-24-8-6-20-26-4/h14,20H,5-12H2,1-4H3,(H,18,22)(H,19,21) |
| InChIKey | UPNJEECKHTZHRP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|