C15H35FN2O4 — CID 155739614
ethane;N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propyl]formamide (PubChem CID 155739614) has the molecular formula C15H35FN2O4 and a molecular weight of 326.45 g/mol. Its IUPAC name is ethane;N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propyl]formamide.
| Compound Name | ethane;N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propyl]formamide |
|---|---|
| PubChem CID | 155739614 |
| Molecular Formula | C15H35FN2O4 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | ethane;N-[2-fluoro-3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propyl]formamide |
| SMILES | CC.CC.CNCCOCCOCCOCC(F)CNC=O |
| InChI | InChI=1S/C11H23FN2O4.2C2H6/c1-13-2-3-16-4-5-17-6-7-18-9-11(12)8-14-10-15;2*1-2/h10-11,13H,2-9H2,1H3,(H,14,15);2*1-2H3 |
| InChIKey | XUHUWRDNOKNJTF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|