C18H42N2O5 — CID 155582612
ethane;N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide;2-methylpropane (PubChem CID 155582612) has the molecular formula C18H42N2O5 and a molecular weight of 366.54 g/mol. Its IUPAC name is ethane;N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide;2-methylpropane.
| Compound Name | ethane;N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide;2-methylpropane |
|---|---|
| PubChem CID | 155582612 |
| Molecular Formula | C18H42N2O5 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | ethane;N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide;2-methylpropane |
| SMILES | CC.CC(C)C.CNCCOCCOCCOCCOCCNC=O |
| InChI | InChI=1S/C12H26N2O5.C4H10.C2H6/c1-13-2-4-16-6-8-18-10-11-19-9-7-17-5-3-14-12-15;1-4(2)3;1-2/h12-13H,2-11H2,1H3,(H,14,15);4H,1-3H3;1-2H3 |
| InChIKey | VQHJOLQZERAZHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|