C12H22N2O5 — CID 174360770
2-[2-(2-formamidoethoxy)ethoxy]-N-(5-oxopentan-2-yl)acetamide (PubChem CID 174360770) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[2-(2-formamidoethoxy)ethoxy]-N-(5-oxopentan-2-yl)acetamide.
| Compound Name | 2-[2-(2-formamidoethoxy)ethoxy]-N-(5-oxopentan-2-yl)acetamide |
|---|---|
| PubChem CID | 174360770 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-[2-(2-formamidoethoxy)ethoxy]-N-(5-oxopentan-2-yl)acetamide |
| SMILES | CC(CCC=O)NC(=O)COCCOCCNC=O |
| InChI | InChI=1S/C12H22N2O5/c1-11(3-2-5-15)14-12(17)9-19-8-7-18-6-4-13-10-16/h5,10-11H,2-4,6-9H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | VJJDMYGTMNSONH-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|