C20H43N5O6 — CID 176965805
2-[3-[2-(2-aminoethoxy)ethoxy]propanoylamino]-N-[1-(2-formamidoethylamino)-1-oxopropan-2-yl]propanamide;ethane (PubChem CID 176965805) has the molecular formula C20H43N5O6 and a molecular weight of 449.59 g/mol. Its IUPAC name is 2-[3-[2-(2-aminoethoxy)ethoxy]propanoylamino]-N-[1-(2-formamidoethylamino)-1-oxopropan-2-yl]propanamide;ethane.
| Compound Name | 2-[3-[2-(2-aminoethoxy)ethoxy]propanoylamino]-N-[1-(2-formamidoethylamino)-1-oxopropan-2-yl]propanamide;ethane |
|---|---|
| PubChem CID | 176965805 |
| Molecular Formula | C20H43N5O6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | 2-[3-[2-(2-aminoethoxy)ethoxy]propanoylamino]-N-[1-(2-formamidoethylamino)-1-oxopropan-2-yl]propanamide;ethane |
| SMILES | CC.CC.CC(NC(=O)CCOCCOCCN)C(=O)NC(C)C(=O)NCCNC=O |
| InChI | InChI=1S/C16H31N5O6.2C2H6/c1-12(15(24)19-6-5-18-11-22)21-16(25)13(2)20-14(23)3-7-26-9-10-27-8-4-17;2*1-2/h11-13H,3-10,17H2,1-2H3,(H,18,22)(H,19,24)(H,20,23)(H,21,25);2*1-2H3 |
| InChIKey | BDUXARKKZWBOBD-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|