C13H25N3O5 — CID 145263560
N-(5-amino-6-oxohexyl)-2-[2-(2-formamidoethoxy)ethoxy]acetamide (PubChem CID 145263560) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(5-amino-6-oxohexyl)-2-[2-(2-formamidoethoxy)ethoxy]acetamide.
| Compound Name | N-(5-amino-6-oxohexyl)-2-[2-(2-formamidoethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 145263560 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-(5-amino-6-oxohexyl)-2-[2-(2-formamidoethoxy)ethoxy]acetamide |
| SMILES | NC(C=O)CCCCNC(=O)COCCOCCNC=O |
| InChI | InChI=1S/C13H25N3O5/c14-12(9-17)3-1-2-4-16-13(19)10-21-8-7-20-6-5-15-11-18/h9,11-12H,1-8,10,14H2,(H,15,18)(H,16,19) |
| InChIKey | YHVPGTPAYSESFD-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|