C17H34N2O8 — CID 177324928
4-amino-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-oxopentanamide (PubChem CID 177324928) has the molecular formula C17H34N2O8 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-oxopentanamide.
| Compound Name | 4-amino-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-oxopentanamide |
|---|---|
| PubChem CID | 177324928 |
| Molecular Formula | C17H34N2O8 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 4-amino-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-oxopentanamide |
| SMILES | NC(C=O)CCC(=O)NCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C17H34N2O8/c18-16(15-21)1-2-17(22)19-3-5-23-7-9-25-11-13-27-14-12-26-10-8-24-6-4-20/h15-16,20H,1-14,18H2,(H,19,22) |
| InChIKey | PQJAECSHCBMBEJ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|