C14H25N3O6 — CID 166729277
4-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-1,5-dioxopentan-2-yl]-5-oxopentanamide (PubChem CID 166729277) has the molecular formula C14H25N3O6 and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-1,5-dioxopentan-2-yl]-5-oxopentanamide.
| Compound Name | 4-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-1,5-dioxopentan-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 166729277 |
| Molecular Formula | C14H25N3O6 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-1,5-dioxopentan-2-yl]-5-oxopentanamide |
| SMILES | NC(C=O)CCC(=O)NC(C=O)CCC(=O)NCCOCCO |
| InChI | InChI=1S/C14H25N3O6/c15-11(9-19)1-3-14(22)17-12(10-20)2-4-13(21)16-5-7-23-8-6-18/h9-12,18H,1-8,15H2,(H,16,21)(H,17,22) |
| InChIKey | IZJFCMUSBFABKC-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|