C29H48N4O14 — CID 130424215
[5-acetamido-3,4-diacetyloxy-6-[2-[2-[[(4S)-4-[[(4S)-4-amino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]ethoxy]ethoxy]-6-hydroxy-2-methylhexyl] acetate (PubChem CID 130424215) has the molecular formula C29H48N4O14 and a molecular weight of 676.72 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-[2-[2-[[(4S)-4-[[(4S)-4-amino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]ethoxy]ethoxy]-6-hydroxy-2-methylhexyl] acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-[2-[2-[[(4S)-4-[[(4S)-4-amino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]ethoxy]ethoxy]-6-hydroxy-2-methylhexyl] acetate |
|---|---|
| PubChem CID | 130424215 |
| Molecular Formula | C29H48N4O14 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-[2-[2-[[(4S)-4-[[(4S)-4-amino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]ethoxy]ethoxy]-6-hydroxy-2-methylhexyl] acetate |
| SMILES | CC(=O)NC(C(O)OCCOCCNC(=O)CC[C@@H](C=O)NC(=O)CC[C@H](N)C=O)C(OC(C)=O)C(OC(C)=O)C(C)COC(C)=O |
| InChI | InChI=1S/C29H48N4O14/c1-17(16-45-19(3)37)27(46-20(4)38)28(47-21(5)39)26(32-18(2)36)29(42)44-13-12-43-11-10-31-24(40)9-7-23(15-35)33-25(41)8-6-22(30)14-34/h14-15,17,22-23,26-29,42H,6-13,16,30H2,1-5H3,(H,31,40)(H,32,36)(H,33,41)/t17?,22-,23-,26?,27?,28?,29?/m0/s1 |
| InChIKey | GAPSRMUZVQLOIS-NUQYQQLFSA-N |
| XLogP | -2.21 |
| TPSA | 265.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|