C22H36N4O11S — CID 139325598
2-[[4-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid (PubChem CID 139325598) has the molecular formula C22H36N4O11S and a molecular weight of 564.61 g/mol. Its IUPAC name is 2-[[4-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-[[4-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139325598 |
| Molecular Formula | C22H36N4O11S |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 2-[[4-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)NS(=O)CCCC(=O)NCCOCCOCC(=O)NC(C=O)CCC(=O)NC(CCC=O)C(=O)O |
| InChI | InChI=1S/C22H36N4O11S/c1-16(29)26-38(35)13-3-5-19(30)23-8-10-36-11-12-37-15-21(32)24-17(14-28)6-7-20(31)25-18(22(33)34)4-2-9-27/h9,14,17-18H,2-8,10-13,15H2,1H3,(H,23,30)(H,24,32)(H,25,31)(H,26,29)(H,33,34) |
| InChIKey | DLWGKDPESXMLRK-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 223.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|