C22H38N4O11S — CID 155264045
2-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-(1-carboxybutylamino)-5-oxopentanoic acid (PubChem CID 155264045) has the molecular formula C22H38N4O11S and a molecular weight of 566.63 g/mol. Its IUPAC name is 2-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-(1-carboxybutylamino)-5-oxopentanoic acid.
| Compound Name | 2-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-(1-carboxybutylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 155264045 |
| Molecular Formula | C22H38N4O11S |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-[[2-[2-[2-(4-acetylsulfinamoylbutanoylamino)ethoxy]ethoxy]acetyl]amino]-5-(1-carboxybutylamino)-5-oxopentanoic acid |
| SMILES | CCCC(NC(=O)CCC(NC(=O)COCCOCCNC(=O)CCCS(=O)NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H38N4O11S/c1-3-5-16(21(31)32)24-19(29)8-7-17(22(33)34)25-20(30)14-37-12-11-36-10-9-23-18(28)6-4-13-38(35)26-15(2)27/h16-17H,3-14H2,1-2H3,(H,23,28)(H,24,29)(H,25,30)(H,26,27)(H,31,32)(H,33,34) |
| InChIKey | NVAYSRDVNQKJEB-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 226.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|