C14H30N2O2 — CID 154671213
N-[8-(methylamino)octyl]-2-propan-2-yloxyacetamide (PubChem CID 154671213) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-[8-(methylamino)octyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-[8-(methylamino)octyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 154671213 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | N-[8-(methylamino)octyl]-2-propan-2-yloxyacetamide |
| SMILES | CNCCCCCCCCNC(=O)COC(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-13(2)18-12-14(17)16-11-9-7-5-4-6-8-10-15-3/h13,15H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | YIXSFJUTXJVAJJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|