C8H17NO3 — CID 172528660
2-propan-2-yloxyethyl N,N-dimethylcarbamate (PubChem CID 172528660) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl N,N-dimethylcarbamate.
| Compound Name | 2-propan-2-yloxyethyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 172528660 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2-propan-2-yloxyethyl N,N-dimethylcarbamate |
| SMILES | CC(C)OCCOC(=O)N(C)C |
| InChI | InChI=1S/C8H17NO3/c1-7(2)11-5-6-12-8(10)9(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | LJFVXXKFXBZEQK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|