C10H18O4 — CID 77005567
3-methyl-4-(2-propan-2-yloxyethoxy)but-2-enoic acid (PubChem CID 77005567) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-methyl-4-(2-propan-2-yloxyethoxy)but-2-enoic acid.
| Compound Name | 3-methyl-4-(2-propan-2-yloxyethoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 77005567 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-methyl-4-(2-propan-2-yloxyethoxy)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)COCCOC(C)C |
| InChI | InChI=1S/C10H18O4/c1-8(2)14-5-4-13-7-9(3)6-10(11)12/h6,8H,4-5,7H2,1-3H3,(H,11,12) |
| InChIKey | OOORHWWAGPIDTO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|