C13H27NO2 — CID 58408951
1-[2-(dimethylamino)ethoxy]-4,5,5-trimethylhexan-3-one (PubChem CID 58408951) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethoxy]-4,5,5-trimethylhexan-3-one.
| Compound Name | 1-[2-(dimethylamino)ethoxy]-4,5,5-trimethylhexan-3-one |
|---|---|
| PubChem CID | 58408951 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-[2-(dimethylamino)ethoxy]-4,5,5-trimethylhexan-3-one |
| SMILES | CC(C(=O)CCOCCN(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-11(13(2,3)4)12(15)7-9-16-10-8-14(5)6/h11H,7-10H2,1-6H3 |
| InChIKey | NAIYXRSRZGPEMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|