C20H42N2O5 — CID 167270132
3-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-methyl-N-(4-methylpentyl)propanamide (PubChem CID 167270132) has the molecular formula C20H42N2O5 and a molecular weight of 390.57 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-methyl-N-(4-methylpentyl)propanamide.
| Compound Name | 3-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-methyl-N-(4-methylpentyl)propanamide |
|---|---|
| PubChem CID | 167270132 |
| Molecular Formula | C20H42N2O5 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 3-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-methyl-N-(4-methylpentyl)propanamide |
| SMILES | CC(C)CCCN(C)C(=O)CCOCCOCCOCCOCCN(C)C |
| InChI | InChI=1S/C20H42N2O5/c1-19(2)7-6-9-22(5)20(23)8-11-24-13-15-26-17-18-27-16-14-25-12-10-21(3)4/h19H,6-18H2,1-5H3 |
| InChIKey | DWIOOIGUQQSFNZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|