C16H28N2O8 — CID 125495900
4-[2-[2-[2-[3-carboxypropanoyl(methyl)amino]ethoxy]ethoxy]ethyl-methylamino]-4-oxobutanoic acid (PubChem CID 125495900) has the molecular formula C16H28N2O8 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[2-[2-[2-[3-carboxypropanoyl(methyl)amino]ethoxy]ethoxy]ethyl-methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-[3-carboxypropanoyl(methyl)amino]ethoxy]ethoxy]ethyl-methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 125495900 |
| Molecular Formula | C16H28N2O8 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-[2-[2-[2-[3-carboxypropanoyl(methyl)amino]ethoxy]ethoxy]ethyl-methylamino]-4-oxobutanoic acid |
| SMILES | CN(CCOCCOCCN(C)C(=O)CCC(=O)O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C16H28N2O8/c1-17(13(19)3-5-15(21)22)7-9-25-11-12-26-10-8-18(2)14(20)4-6-16(23)24/h3-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | SMXRBWWXTZGYCP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|