About N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide
N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide (PubChem CID 23377103) has the molecular formula C16H33N3O5
and a molecular weight of 347.46 g/mol. Its IUPAC name is N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide.
Molecular Properties
| Compound Name | N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide |
| PubChem CID | 23377103 |
| Molecular Formula | C16H33N3O5 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide |
| SMILES | CNC(=O)CCC(=O)N(C)CCOCCOCCOCCN(C)C |
| InChI | InChI=1S/C16H33N3O5/c1-17-15(20)5-6-16(21)19(4)8-10-23-12-14-24-13-11-22-9-7-18(2)3/h5-14H2,1-4H3,(H,17,20) |
| InChIKey | SWXJEAMBAFWYSC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide?
The IUPAC name of N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide (CID 23377103) is N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide.
What is the SMILES notation for N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide?
The canonical SMILES for N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide is CNC(=O)CCC(=O)N(C)CCOCCOCCOCCN(C)C.
What is the InChIKey of N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide?
The InChIKey is SWXJEAMBAFWYSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3O5/c1-17-15(20)5-6-16(21)19(4)8-10-23-12-14-24-13-11-22-9-7-18(2)3/h5-14H2,1-4H3,(H,17,20).
What are the key properties of N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide?
N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide has a molecular weight of 347.46 g/mol, XLogP of -0.42, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide is sourced from PubChem (CID 23377103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).