C16H33N3O5 — CID 23377103
N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide (PubChem CID 23377103) has the molecular formula C16H33N3O5 and a molecular weight of 347.46 g/mol. Its IUPAC name is N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide.
| Compound Name | N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide |
|---|---|
| PubChem CID | 23377103 |
| Molecular Formula | C16H33N3O5 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N'-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethyl]-N,N'-dimethylbutanediamide |
| SMILES | CNC(=O)CCC(=O)N(C)CCOCCOCCOCCN(C)C |
| InChI | InChI=1S/C16H33N3O5/c1-17-15(20)5-6-16(21)19(4)8-10-23-12-14-24-13-11-22-9-7-18(2)3/h5-14H2,1-4H3,(H,17,20) |
| InChIKey | SWXJEAMBAFWYSC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|