C9H19NO4 — CID 58019725
3-[2-(2-methoxyethoxy)ethoxy]-N-methylpropanamide (PubChem CID 58019725) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethoxy]-N-methylpropanamide.
| Compound Name | 3-[2-(2-methoxyethoxy)ethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 58019725 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethoxy]-N-methylpropanamide |
| SMILES | CNC(=O)CCOCCOCCOC |
| InChI | InChI=1S/C9H19NO4/c1-10-9(11)3-4-13-7-8-14-6-5-12-2/h3-8H2,1-2H3,(H,10,11) |
| InChIKey | MLUYHOIUMPMFEK-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|