C9H23NO2 — CID 178014406
ethane;3-methoxy-N-methylpropanamide (PubChem CID 178014406) has the molecular formula C9H23NO2 and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;3-methoxy-N-methylpropanamide.
| Compound Name | ethane;3-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 178014406 |
| Molecular Formula | C9H23NO2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.17 |
| IUPAC Name | ethane;3-methoxy-N-methylpropanamide |
| SMILES | CC.CC.CNC(=O)CCOC |
| InChI | InChI=1S/C5H11NO2.2C2H6/c1-6-5(7)3-4-8-2;2*1-2/h3-4H2,1-2H3,(H,6,7);2*1-2H3 |
| InChIKey | VTDLJQGBSOVWCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |