C11H25NO2 — CID 142389980
ethane;7-methoxy-N-methylheptanamide (PubChem CID 142389980) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;7-methoxy-N-methylheptanamide.
| Compound Name | ethane;7-methoxy-N-methylheptanamide |
|---|---|
| PubChem CID | 142389980 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | ethane;7-methoxy-N-methylheptanamide |
| SMILES | CC.CNC(=O)CCCCCCOC |
| InChI | InChI=1S/C9H19NO2.C2H6/c1-10-9(11)7-5-3-4-6-8-12-2;1-2/h3-8H2,1-2H3,(H,10,11);1-2H3 |
| InChIKey | FUVFHQLCSMNAFR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|