C11H23NO4 — CID 134579969
4-[3-(2-methoxyethoxy)propoxy]-N-methylbutanamide (PubChem CID 134579969) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-[3-(2-methoxyethoxy)propoxy]-N-methylbutanamide.
| Compound Name | 4-[3-(2-methoxyethoxy)propoxy]-N-methylbutanamide |
|---|---|
| PubChem CID | 134579969 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-[3-(2-methoxyethoxy)propoxy]-N-methylbutanamide |
| SMILES | CNC(=O)CCCOCCCOCCOC |
| InChI | InChI=1S/C11H23NO4/c1-12-11(13)5-3-6-15-7-4-8-16-10-9-14-2/h3-10H2,1-2H3,(H,12,13) |
| InChIKey | SDONDTJKBNTKDZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|