C11H22N2O4 — CID 163393368
N-methyl-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide (PubChem CID 163393368) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-methyl-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide.
| Compound Name | N-methyl-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 163393368 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N-methyl-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide |
| SMILES | CCC(=O)NCCOCCOCCC(=O)NC |
| InChI | InChI=1S/C11H22N2O4/c1-3-10(14)13-5-7-17-9-8-16-6-4-11(15)12-2/h3-9H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | NNCVOTPOAKANDR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|