C10H19NO3 — CID 115163571
3-[methyl(4-methylpentyl)amino]-3-oxopropanoic acid (PubChem CID 115163571) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-[methyl(4-methylpentyl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[methyl(4-methylpentyl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115163571 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 3-[methyl(4-methylpentyl)amino]-3-oxopropanoic acid |
| SMILES | CC(C)CCCN(C)C(=O)CC(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-8(2)5-4-6-11(3)9(12)7-10(13)14/h8H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | QPGYODQPHFZRIO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|