C11H20GdO2 — CID 87359208
gadolinium;6,7,7-trimethyloctane-3,5-dione (PubChem CID 87359208) has the molecular formula C11H20GdO2 and a molecular weight of 341.53 g/mol. Its IUPAC name is gadolinium;6,7,7-trimethyloctane-3,5-dione.
| Compound Name | gadolinium;6,7,7-trimethyloctane-3,5-dione |
|---|---|
| PubChem CID | 87359208 |
| Molecular Formula | C11H20GdO2 |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | gadolinium;6,7,7-trimethyloctane-3,5-dione |
| SMILES | CCC(=O)CC(=O)C(C)C(C)(C)C.[Gd] |
| InChI | InChI=1S/C11H20O2.Gd/c1-6-9(12)7-10(13)8(2)11(3,4)5;/h8H,6-7H2,1-5H3; |
| InChIKey | TUCIAMYKTFGEGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|