About 2-methyl-3-oxopentanoyl fluoride
2-methyl-3-oxopentanoyl fluoride (PubChem CID 174997525) has the molecular formula C6H9FO2
and a molecular weight of 132.13 g/mol. Its IUPAC name is 2-methyl-3-oxopentanoyl fluoride.
Molecular Properties
| Compound Name | 2-methyl-3-oxopentanoyl fluoride |
| PubChem CID | 174997525 |
| Molecular Formula | C6H9FO2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-methyl-3-oxopentanoyl fluoride |
| SMILES | CCC(=O)C(C)C(=O)F |
| InChI | InChI=1S/C6H9FO2/c1-3-5(8)4(2)6(7)9/h4H,3H2,1-2H3 |
| InChIKey | DBWCLMKJIWUMMC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-oxopentanoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-oxopentanoyl fluoride?
The IUPAC name of 2-methyl-3-oxopentanoyl fluoride (CID 174997525) is 2-methyl-3-oxopentanoyl fluoride.
What is the SMILES notation for 2-methyl-3-oxopentanoyl fluoride?
The canonical SMILES for 2-methyl-3-oxopentanoyl fluoride is CCC(=O)C(C)C(=O)F.
What is the InChIKey of 2-methyl-3-oxopentanoyl fluoride?
The InChIKey is DBWCLMKJIWUMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FO2/c1-3-5(8)4(2)6(7)9/h4H,3H2,1-2H3.
What are the key properties of 2-methyl-3-oxopentanoyl fluoride?
2-methyl-3-oxopentanoyl fluoride has a molecular weight of 132.13 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxopentanoyl fluoride is sourced from PubChem (CID 174997525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).