C8H12O2 — CID 12712038
4-methylhept-1-ene-3,5-dione (PubChem CID 12712038) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 4-methylhept-1-ene-3,5-dione.
| Compound Name | 4-methylhept-1-ene-3,5-dione |
|---|---|
| PubChem CID | 12712038 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 4-methylhept-1-ene-3,5-dione |
| SMILES | C=CC(=O)C(C)C(=O)CC |
| InChI | InChI=1S/C8H12O2/c1-4-7(9)6(3)8(10)5-2/h4,6H,1,5H2,2-3H3 |
| InChIKey | HELMBJIEQXVVSI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|