C9H13NO3 — CID 139752538
N-(2,4-dioxohexan-3-yl)prop-2-enamide (PubChem CID 139752538) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-(2,4-dioxohexan-3-yl)prop-2-enamide.
| Compound Name | N-(2,4-dioxohexan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 139752538 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-(2,4-dioxohexan-3-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C(C)=O)C(=O)CC |
| InChI | InChI=1S/C9H13NO3/c1-4-7(12)9(6(3)11)10-8(13)5-2/h5,9H,2,4H2,1,3H3,(H,10,13) |
| InChIKey | RYVRBLYCAAQLGE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|