C7H13NO3 — CID 174879831
N-(1,2-dihydroxybutyl)prop-2-enamide (PubChem CID 174879831) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is N-(1,2-dihydroxybutyl)prop-2-enamide.
| Compound Name | N-(1,2-dihydroxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 174879831 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | N-(1,2-dihydroxybutyl)prop-2-enamide |
| SMILES | C=CC(=O)NC(O)C(O)CC |
| InChI | InChI=1S/C7H13NO3/c1-3-5(9)7(11)8-6(10)4-2/h4-5,7,9,11H,2-3H2,1H3,(H,8,10) |
| InChIKey | OPJGSVJCIVWWIO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|