C6H12N2O3 — CID 144596599
N-[1,2-dihydroxy-2-(methylamino)ethyl]prop-2-enamide (PubChem CID 144596599) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is N-[1,2-dihydroxy-2-(methylamino)ethyl]prop-2-enamide.
| Compound Name | N-[1,2-dihydroxy-2-(methylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 144596599 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | N-[1,2-dihydroxy-2-(methylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(O)C(O)NC |
| InChI | InChI=1S/C6H12N2O3/c1-3-4(9)8-6(11)5(10)7-2/h3,5-7,10-11H,1H2,2H3,(H,8,9) |
| InChIKey | LIWLBLJSPLHQQA-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|