C5H6NO4- — CID 6931091
(2R)-2-hydroxy-2-(prop-2-enoylamino)acetate (PubChem CID 6931091) has the molecular formula C5H6NO4- and a molecular weight of 144.11 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-(prop-2-enoylamino)acetate.
| Compound Name | (2R)-2-hydroxy-2-(prop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 6931091 |
| Molecular Formula | C5H6NO4- |
| Molecular Weight | 144.11 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (2R)-2-hydroxy-2-(prop-2-enoylamino)acetate |
| SMILES | C=CC(=O)N[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C5H7NO4/c1-2-3(7)6-4(8)5(9)10/h2,4,8H,1H2,(H,6,7)(H,9,10)/p-1/t4-/m1/s1 |
| InChIKey | NEYTXADIGVEHQD-SCSAIBSYSA-M |
| XLogP | -2.64 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.11 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|