C9H17NO5 — CID 18997976
ethyl 2-hydroxy-2-(prop-2-enoylamino)acetate;methoxymethane (PubChem CID 18997976) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(prop-2-enoylamino)acetate;methoxymethane.
| Compound Name | ethyl 2-hydroxy-2-(prop-2-enoylamino)acetate;methoxymethane |
|---|---|
| PubChem CID | 18997976 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | ethyl 2-hydroxy-2-(prop-2-enoylamino)acetate;methoxymethane |
| SMILES | C=CC(=O)NC(O)C(=O)OCC.COC |
| InChI | InChI=1S/C7H11NO4.C2H6O/c1-3-5(9)8-6(10)7(11)12-4-2;1-3-2/h3,6,10H,1,4H2,2H3,(H,8,9);1-2H3 |
| InChIKey | JCECIDZYJSHXPD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|