C7H9N2O5S- — CID 140789014
bis(prop-2-enoylamino)methanesulfonate (PubChem CID 140789014) has the molecular formula C7H9N2O5S- and a molecular weight of 233.22 g/mol. Its IUPAC name is bis(prop-2-enoylamino)methanesulfonate.
| Compound Name | bis(prop-2-enoylamino)methanesulfonate |
|---|---|
| PubChem CID | 140789014 |
| Molecular Formula | C7H9N2O5S- |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | bis(prop-2-enoylamino)methanesulfonate |
| SMILES | C=CC(=O)NC(NC(=O)C=C)S(=O)(=O)[O-] |
| InChI | InChI=1S/C7H10N2O5S/c1-3-5(10)8-7(15(12,13)14)9-6(11)4-2/h3-4,7H,1-2H2,(H,8,10)(H,9,11)(H,12,13,14)/p-1 |
| InChIKey | STZXYVJGAOVALB-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|