C13H24NNaO4S — CID 141391834
sodium 2-(prop-2-enoylamino)decane-1-sulfonate (PubChem CID 141391834) has the molecular formula C13H24NNaO4S and a molecular weight of 313.40 g/mol. Its IUPAC name is sodium 2-(prop-2-enoylamino)decane-1-sulfonate.
| Compound Name | sodium 2-(prop-2-enoylamino)decane-1-sulfonate |
|---|---|
| PubChem CID | 141391834 |
| Molecular Formula | C13H24NNaO4S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | sodium 2-(prop-2-enoylamino)decane-1-sulfonate |
| SMILES | C=CC(=O)NC(CCCCCCCC)CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H25NO4S.Na/c1-3-5-6-7-8-9-10-12(11-19(16,17)18)14-13(15)4-2;/h4,12H,2-3,5-11H2,1H3,(H,14,15)(H,16,17,18);/q;+1/p-1 |
| InChIKey | GVUPAPNQFUVSGM-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|